CAS 18381-53-8
:4-carbethoxyhexafluorobutyryl chloride
Description:
4-Carbethoxyhexafluorobutyryl chloride is a chemical compound characterized by its unique structure, which includes a hexafluorobutyryl moiety and an ethyl carbethoxy group. This compound is typically a colorless to pale yellow liquid, exhibiting a pungent odor due to the presence of the acyl chloride functional group. It is known for its reactivity, particularly in acylation reactions, where it can act as a potent acylating agent. The presence of six fluorine atoms contributes to its high electronegativity and lipophilicity, which can influence its solubility and reactivity in organic solvents. Additionally, the compound is sensitive to moisture and can hydrolyze to form the corresponding carboxylic acid and hydrochloric acid, necessitating careful handling and storage under anhydrous conditions. Due to its chemical properties, 4-carbethoxyhexafluorobutyryl chloride is of interest in various synthetic applications, particularly in the fields of organic synthesis and materials science. Safety precautions are essential when working with this compound due to its corrosive nature and potential health hazards.
Formula:C7H5ClF6O2
InChI:InChI=1/C7H5ClF6O3/c1-2-17-4(16)6(11,12)7(13,14)5(9,10)3(8)15/h2H2,1H3
SMILES:CCOC(=O)C(C(C(C(=O)Cl)(F)F)(F)F)(F)F
Synonyms:- 4-Carboethoxyhexafluorobutyryl chloride~Hexafluoroglutaric acid monoethyl ester chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl hexafluoroglutaryl chloride, 97%
CAS:Ethyl hexafluoroglutaryl chloride is used as a derivatising agent in gas chromatography. It is an active reagent used for the quantization of amphetamine and methamphetamine in urine by gas chromatography/mass spectroscopy (GC/MS). This Thermo Scientific Chemicals brand product was originally part oFormula:C7H5ClF6O3Purity:97%Molecular weight:286.56Ethyl hexafluoroglutaryl chloride
CAS:Ethyl hexafluoroglutaryl chloride
Formula:C7H5ClF6O3Purity:97Color and Shape: clear liquidMolecular weight:286.56g/molEthyl hexafluoroglutaryl chloride
CAS:Ethyl hexafluOrOglutaryl chlOride is a tricyclic antidepressant drug that belongs to the class of drugs known as monoamine oxidase inhibitors. It can be used to treat depression and other mood disorders. Ethyl hexafluOrOglutaryl chlOride inhibits the enzyme monoamine oxidase, which is responsible for breaking down amines such as serotonin and norepinephrine in the brain. This leads to an increase in the levels of these neurotransmitters, which are important for mood regulation. The presence of this drug in urine samples can be detected using a spectrometric analytical method. It can also be detected in blood samples by chemical ionization with gas chromatography-mass spectrometry (GC-MS).Formula:C7H5ClF6O3Purity:95%NmrMolecular weight:286.55 g/mol



