CymitQuimica logo

CAS 18381-60-7

:

2-(cyclopropylamino)-1-phenylethanone

Description:
2-(Cyclopropylamino)-1-phenylethanone, with the CAS number 18381-60-7, is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a phenyl group attached to an ethanone moiety. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the amino group and reactivity typical of carbonyl compounds. It may appear as a solid or liquid depending on the specific conditions, and its solubility can vary in different solvents, often being more soluble in organic solvents than in water. The presence of the cyclopropyl group can influence its steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could contribute to biological activity. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c13-11(8-12-10-6-7-10)9-4-2-1-3-5-9/h1-5,10,12H,6-8H2
SMILES:c1ccc(cc1)C(=O)CNC1CC1
Synonyms:
  • Ethanone, 2-(cyclopropylamino)-1-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.