CAS 183814-30-4
:Formoterol fumarate dihydrate
Description:
Formoterol fumarate dihydrate is a long-acting beta-2 adrenergic agonist primarily used in the management of asthma and chronic obstructive pulmonary disease (COPD). It is characterized by its ability to relax bronchial smooth muscle, leading to bronchodilation and improved airflow. The substance is a white to off-white crystalline powder, soluble in water, and has a molecular formula that reflects its dihydrate form, indicating the presence of water molecules in its crystalline structure. Formoterol fumarate dihydrate exhibits a prolonged duration of action, typically lasting up to 12 hours, which makes it suitable for both maintenance and rescue therapy in respiratory conditions. Its pharmacokinetics involve rapid absorption and a relatively high bioavailability when administered via inhalation. Additionally, it is often combined with corticosteroids to enhance therapeutic efficacy and reduce inflammation in the airways. As with any medication, it is essential to monitor for potential side effects, including cardiovascular effects and paradoxical bronchospasm.
Formula:C23H32N2O10
InChI:InChI=1/C19H24N2O4.C4H4O4.2H2O/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22;5-3(6)1-2-4(7)8;;/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22);1-2H,(H,5,6)(H,7,8);2*1H2/b;2-1+;;/t13-,19+;;;/m1.../s1
Synonyms:- (R*,R*)-N-[2-Hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide fumarate dihydrate
- N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide (2E)-but-2-enedioate hydrate (1:1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Formoterol Fumarate
CAS:<p>Aromatic cyclic amides (including cyclic carbamates) and their derivatives; salts thereof</p>Formula:(C19H24N2O4)2·C4H4O4·2H2OColor and Shape:White Off-White PowderMolecular weight:688.34721Formoterol fumarate dihydrate
CAS:Formula:C42H56N4O14Purity:98%Color and Shape:SolidMolecular weight:840.9124Formoterol fumarate dihydrate
CAS:Formula:C42H56N4O14Purity:(Titration) ≥ 98.0% (anhydrous basis)Color and Shape:White to almost white powderMolecular weight:840.91Formoterol fumarate dihydrate
CAS:Controlled ProductFormula:C19H24N2O4·C4H4O4H2OColor and Shape:NeatMolecular weight:840.91Formoterol Fumarate Dihydrate
CAS:Formula:C19H24N2O4·C4H4O4H2OColor and Shape:NeatMolecular weight:804.9Formoterol fumarate dihydrate
CAS:Controlled Product<p>beta2-adrenoreceptor agonist; anti-asthmatic</p>Formula:C42H52N4O12·2H2OPurity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:840.91 g/mol









