CymitQuimica logo

CAS 18387-26-3

:

1,1,3,3-tetramethyl-1-(prop-2-en-1-yl)disiloxane

Description:
1,1,3,3-Tetramethyl-1-(prop-2-en-1-yl)disiloxane is an organosilicon compound characterized by its unique siloxane structure, which consists of silicon-oxygen bonds. This compound features two silicon atoms, each bonded to two methyl groups and one vinyl group, contributing to its distinctive reactivity and properties. The presence of the vinyl group allows for potential polymerization reactions, making it useful in various applications, including silicone-based materials and coatings. The compound is typically colorless to pale yellow and may have a low viscosity, depending on its concentration. It is generally stable under normal conditions but may undergo reactions when exposed to strong acids or bases. Its low volatility and moderate solubility in organic solvents make it suitable for use in formulations requiring silicone-based additives. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1,1,3,3-tetramethyl-1-(prop-2-en-1-yl)disiloxane is valued in industrial applications for its unique chemical properties and versatility.
Formula:C7H18OSi2
InChI:InChI=1/C7H18OSi2/c1-6-7-10(4,5)8-9(2)3/h6,9H,1,7H2,2-5H3
SMILES:C=CC[Si](C)(C)O[SiH](C)C
Synonyms:
  • 1-Allyl-1,1,3,3-tetramethyldisiloxane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.