CAS 184031-16-1

(1H-INDOL-5-YL)-CARBAMIC ACID TERT-BUTYL ESTER

Description:

(1H-Indol-5-yl)-carbamic acid tert-butyl ester, with the CAS number 184031-16-1, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features a carbamic acid moiety, which is an amide derived from carbonic acid, and is esterified with tert-butyl alcohol, contributing to its stability and solubility in organic solvents. The presence of the indole group often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. Typically, compounds like this may exhibit properties such as moderate to high lipophilicity, influencing their pharmacokinetics and bioavailability. Additionally, the tert-butyl ester group can enhance the compound's stability and facilitate its synthesis. Overall, this compound may serve as a valuable intermediate in the synthesis of more complex molecules or as a potential therapeutic agent, depending on its specific interactions and biological effects.

Formula: C₁₃H₁₆N₂O₂

InChI: InChI=1/C13H16N2O2/c1-13(2,3)17-12(16)15-10-4-5-11-9(8-10)6-7-14-11/h4-8,14H,1-3H3,(H,15,16)

SMILES: CC(C)(C)OC(=O)Nc1ccc2c(cc[nH]2)c1

Synonyms:

• 5-Boc-Amino-1H-Indole
• 5-N-Boc-Amino-1H-Indole
• tert-butyl 1H-indol-5-ylcarbamate

tert-Butyl 1H-indol-5-ylcarbamate

CAS: 184031-16-1

Formula: C₁₃H₁₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.2783

Ref: IN-DA0075VB

tert-Butyl 1H-indol-5-ylcarbamate

CAS: 184031-16-1

tert-Butyl 1H-indol-5-ylcarbamate

Purity: 98%

Molecular weight: 232.28g/mol

Ref: 54-OR79652

5-N-Boc-Amino-1H-Indole

CAS: 184031-16-1

Formula: C₁₃H₁₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 232.283

Ref: 10-F040799