CAS 18404-55-2
:Methyl Tri-O-acetyl-1-naphthol Glucuronate
Description:
Methyl Tri-O-acetyl-1-naphthol Glucuronate, with the CAS number 18404-55-2, is a chemical compound that belongs to the class of glucuronides, which are derivatives of glucuronic acid. This compound is characterized by the presence of a naphthol moiety, which contributes to its aromatic properties, and three acetyl groups that enhance its solubility and stability. The glucuronate portion of the molecule is significant for its role in biological processes, particularly in the detoxification and excretion of various substances in the body. Methyl Tri-O-acetyl-1-naphthol Glucuronate is typically a white to off-white solid, and it is soluble in organic solvents due to its acetyl groups. Its structure allows for potential applications in pharmaceuticals and biochemistry, particularly in studies related to drug metabolism and the development of prodrugs. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C23H24O10
InChI:InChI=1/C23H24O10/c1-12(24)29-18-19(30-13(2)25)21(31-14(3)26)23(33-20(18)22(27)28-4)32-17-11-7-9-15-8-5-6-10-16(15)17/h5-11,18-21,23H,1-4H3/t18-,19-,20?,21-,23+/m0/s1
Synonyms:- 1-Naphthol 2,3,4-Tri-O-acetyl--D-glucuronide Methyl Ester
- 1-Naphthyl--D-glucopyranosiduronic Acid Methyl Ester Triacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Naphthol 2,3,4-Tri-O-acetyl-β-D-glucuronide Methyl Ester
CAS:Controlled ProductApplications Intermediate for the synthesis of 1-Naphthol β-D-Glucuronide.
Formula:C23H24O10Color and Shape:NeatMolecular weight:460.43
