CAS 18404-72-3
:BENZYL 4-O-B-D-GALACTOPYRANOSYL-B-D-
Description:
Benzyl 4-O-β-D-galactopyranosyl-β-D-glucopyranoside, identified by the CAS number 18404-72-3, is a glycoside compound characterized by the presence of a benzyl group attached to a galactopyranosyl moiety, which is further linked to a glucopyranosyl unit. This compound typically exhibits properties associated with glycosides, such as solubility in polar solvents and potential biological activity, including antimicrobial or antioxidant effects. The presence of sugar units suggests that it may participate in various biochemical interactions, possibly influencing cellular processes. Its structural features may also contribute to its stability and reactivity under different conditions. As a glycoside, it may undergo hydrolysis in the presence of acids or enzymes, releasing the aglycone (benzyl) and the sugar components. This compound is of interest in fields such as medicinal chemistry and biochemistry, where it may be studied for its potential therapeutic applications or as a tool for understanding carbohydrate interactions in biological systems.
Formula:C22H32O11
InChI:InChI=1/C22H32O11/c1-22(2)32-18-13(9-24)30-21(16(27)19(18)33-22)31-17-12(8-23)29-20(15(26)14(17)25)28-10-11-6-4-3-5-7-11/h3-7,12-21,23-27H,8-10H2,1-2H3
SMILES:CC1(C)OC2C(CO)OC(C(C2O1)O)OC1C(CO)OC(C(C1O)O)OCc1ccccc1
Synonyms:- Benzyl 4-O-B-D-Galactopyranosyl-B-D-Gluc Opyranosid
- Benzyl 4-O-Β-D-Galactopyranosyl-Β-D-Glucopyranoside
- Β-D-Gal-(1→4)-Β-D-Glc-1→Och2Ph
- Benzyl4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
- Benzyl β-lactoside, β-D-Gal-(1-4)-β-D-Glc-1-OCH2Ph
- benzyl 4-O-[3,4-O-(1-methylethylidene)hexopyranosyl]hexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzyl beta-D-Lactoside
CAS:Controlled ProductFormula:C19H28O11Color and Shape:NeatMolecular weight:432.42Benzyl 4-O-(β-D-galactopyranosyl)-β-D-glucopyranoside
CAS:Benzyl 4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is a Glycosylation product that is custom synthesized to order. It is an oligosaccharide, which is synthesized by the modification of monosaccharides with other saccharides. This product has been fluorinated and acetylated at its C4 position and methylated at its C6 position. This compound has CAS No. 18404-72-3 and can be used as a sugar in the synthesis of complex carbohydrates or as a component of polysaccharides.Formula:C19H28O11Purity:Min. 95%Color and Shape:PowderMolecular weight:432.42 g/mol


