CAS 1841081-68-2

4-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

4-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The compound features a tetrahydroisoquinoline moiety, indicating that it has undergone partial hydrogenation, which contributes to its unique chemical properties and potential biological activity. It may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. The hydrochloride form enhances its stability and solubility, facilitating its use in various applications, including research and potential therapeutic contexts. As with many organic compounds, handling should be done with care, considering safety data and proper laboratory protocols. Overall, this compound represents a significant intersection of organic chemistry and pharmacology, warranting further investigation into its properties and applications.

Formula: C₁₀H₁₁NO₂·ClH

InChI: InChI=1S/C10H11NO2.ClH/c12-10(13)9-6-11-5-7-3-1-2-4-8(7)9;/h1-4,9,11H,5-6H2,(H,12,13);1H

InChI key: InChIKey=QGEPUXKEOGYFMZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(CNC1)=CC=CC2.Cl

Synonyms:

• 4-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-, hydrochloride (1:1)