
CAS 1841081-69-3
:5-Fluoro-α-(5-fluoro-2-pyridinyl)-2-pyridineacetonitrile
Description:
5-Fluoro-α-(5-fluoro-2-pyridinyl)-2-pyridineacetonitrile is a chemical compound characterized by its unique structure, which includes multiple fluorine substituents and pyridine rings. This compound features a nitrile functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of the molecule, making it of interest in pharmaceutical research and development. The pyridine rings can participate in coordination chemistry and may influence the compound's biological activity. Additionally, the compound's molecular structure suggests potential uses in agrochemicals or as a building block in organic synthesis. Its CAS number, 1841081-69-3, allows for precise identification and retrieval of information in chemical databases. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H7F2N3
InChI:InChI=1S/C12H7F2N3/c13-8-1-3-11(16-6-8)10(5-15)12-4-2-9(14)7-17-12/h1-4,6-7,10H
InChI key:InChIKey=ATYHUUDKLYDUAC-UHFFFAOYSA-N
SMILES:C(C#N)(C1=CC=C(F)C=N1)C2=CC=C(F)C=N2
Synonyms:- 2-Pyridineacetonitrile, 5-fluoro-α-(5-fluoro-2-pyridinyl)-
- 5-Fluoro-α-(5-fluoro-2-pyridinyl)-2-pyridineacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
