CAS 184154-42-5

2-Thiazolecarboxaldehyde, 4-(1-methylethyl)- (9CI)

Description:

2-Thiazolecarboxaldehyde, 4-(1-methylethyl)-, also known by its CAS number 184154-42-5, is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an aldehyde functional group (-CHO) attached to a thiazole ring, along with an isopropyl group (1-methylethyl) at the 4-position of the thiazole. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its unique structure allows for various chemical transformations, which can be utilized in the development of new materials or compounds. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₉NOS

InChI: InChI=1/C7H9NOS/c1-5(2)6-4-10-7(3-9)8-6/h3-5H,1-2H3

SMILES: CC(C)c1csc(C=O)n1

Synonyms:

• 4-(1-Methylethyl)-1,3-Thiazole-2-Carbaldehyde

4-isopropyl-1,3-thiazole-2-carbaldehyde

CAS: 184154-42-5

Formula: C₇H₉NOS

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 155.22

Ref: 10-F308773