CAS 184163-49-3
:2-chloro-5-hydrazinylbenzoic acid hydrochloride (1:1)
Description:
2-Chloro-5-hydrazinylbenzoic acid hydrochloride (1:1) is a chemical compound characterized by its hydrazine and carboxylic acid functional groups, which contribute to its reactivity and potential applications in medicinal chemistry. The presence of a chlorine atom at the 2-position of the benzoic acid ring enhances its electrophilic properties, making it suitable for various chemical reactions. The hydrazinyl group at the 5-position can participate in condensation reactions, potentially leading to the formation of hydrazones or other derivatives. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for biological assays and pharmaceutical formulations. This compound may exhibit biological activity, making it of interest in drug development, particularly in the context of anti-cancer or anti-inflammatory agents. However, specific safety and handling precautions should be observed due to the presence of the hydrazine moiety, which is known for its toxicity and potential carcinogenicity. Overall, 2-chloro-5-hydrazinylbenzoic acid hydrochloride is a versatile compound with significant implications in chemical research and development.
Formula:C7H8Cl2N2O2
InChI:InChI=1/C7H7ClN2O2.ClH/c8-6-2-1-4(10-9)3-5(6)7(11)12;/h1-3,10H,9H2,(H,11,12);1H
SMILES:c1cc(c(cc1NN)C(=O)O)Cl.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Chloro-5-hydrazinylbenzoic acid hydrochloride
CAS:2-Chloro-5-hydrazinylbenzoic acid hydrochloride (CHB) is a costimulatory molecule that activates the immune system. It binds to the receptor CTLA-4 and prevents it from binding to its ligand, B7. This prevents the inhibitory signal from being transmitted to T cells and leads to an increase in immune responses. CHB has been shown to be effective in treating bladder cancer as well as other cancer types such as colorectal cancer and esophageal cancer. In addition, this drug has anti-inflammatory effects, which can be attributed to its ability to activate monocytes and macrophages, leading to production of cytokines such as IL-1β and IL-6.Formula:C7H8Cl2N2O2Purity:Min. 95%Molecular weight:223.05 g/mol
