CAS 1842-62-2
:2-(2-Ethoxyphenyl)-4,5-diphenylimidazole-1,2'-dimer
Description:
2-(2-Ethoxyphenyl)-4,5-diphenylimidazole-1,2'-dimer, with the CAS number 1842-62-2, is a chemical compound characterized by its complex structure, which includes imidazole rings and phenyl groups. This compound typically exhibits properties associated with organic compounds, such as moderate solubility in organic solvents and potential stability under standard conditions. The presence of ethoxy and phenyl substituents suggests that it may possess interesting electronic and steric properties, which could influence its reactivity and interactions with other molecules. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical and materials science research. The imidazole moiety is known for its role in various biological systems, and the dimerization aspect may enhance its stability or alter its functional properties. Overall, this compound's unique structural features contribute to its potential applications in various fields, including medicinal chemistry and organic synthesis.
Formula:C46H38N4O2
InChI:InChI=1/C46H38N4O2/c1-3-51-39-31-19-17-29-37(39)45-47-43(35-25-13-7-14-26-35)44(36-27-15-8-16-28-36)50(45)46(38-30-18-20-32-40(38)52-4-2)48-41(33-21-9-5-10-22-33)42(49-46)34-23-11-6-12-24-34/h5-32H,3-4H2,1-2H3
InChI key:YROIEOIEMOCPOS-UHFFFAOYSA-N
SMILES:CCOc1ccccc1c1nc(c2ccccc2)c(c2ccccc2)n1C1(c2ccccc2OCC)N=C(c2ccccc2)C(=N1)c1ccccc1
Synonyms:- 2-(O-Ethoxy)-4,5-Diphenylimidazole-1,2'-Dimer
- 2-(o-Ethoxy) phenyl -4,5-diphenylimidazole-1,2'-dimer
- 2-(O-Ethoxy)-4,5-diphenylimidazole-1,2-dimere
- 2,2'-bis(2-ethoxyphenyl)-4,4',5,5'-tetraphenyl-2'H-1,2'-biimidazole
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery