CAS 1842-70-2
:methyl 10-oxooctadecanoate
Description:
Methyl 10-oxooctadecanoate, with the CAS number 1842-70-2, is an ester derived from octadecanoic acid (stearic acid) and methanol, featuring a ketone functional group at the 10th carbon position. This compound typically appears as a colorless to pale yellow liquid with a characteristic fatty odor. It is soluble in organic solvents but has limited solubility in water due to its long hydrophobic carbon chain. Methyl 10-oxooctadecanoate is of interest in various applications, including as a potential flavoring agent, fragrance component, or in the synthesis of other chemical compounds. Its chemical structure contributes to its properties, such as its melting and boiling points, which are influenced by the length of the carbon chain and the presence of functional groups. Additionally, it may exhibit biological activity, making it relevant in fields like biochemistry and pharmacology. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C19H36O3
InChI:InChI=1/C19H36O3/c1-3-4-5-6-7-9-12-15-18(20)16-13-10-8-11-14-17-19(21)22-2/h3-17H2,1-2H3
SMILES:CCCCCCCCCC(=O)CCCCCCCC(=O)OC
Synonyms:- Methyl 9-Oxooctadecanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Octadecanoic acid,9-oxo-, methyl ester
CAS:Formula:C19H36O3Purity:95%Color and Shape:SolidMolecular weight:312.4873Methyl 10-Oxooctadecanoate-d19
CAS:Controlled Product<p>Applications Methyl 10-Oxooctadecanoate-d19 is the isotope labelled analog of Methyl 10-Oxooctadecanoate. Methyl 10-oxooctadecanoate is a long-chain aliphatic acid ester found in extracts from hardwood.<br>References Abe, Z. et al.: Tok. Daig. Nogak. Ensh. Hok., 67, 16 (1975); Buist, P.H. et al.: J. Chem. Soc. Perk. Trans. Org. Bio-Org. Chem., 17, 2617 (1997);<br></p>Formula:C19D19H17O3Color and Shape:NeatMolecular weight:331.604Methyl 10-Oxooctadecanoate
CAS:Controlled ProductFormula:C19H36O3Color and Shape:NeatMolecular weight:312.49



