CAS 1842-72-4

nonanediamide

Description:

Nonanediamide, also known as 1,9-nonanediamine, is an organic compound characterized by its amide functional groups located at both ends of a nine-carbon alkyl chain. Its molecular formula is C9H18N2O, indicating the presence of two amine groups (-NH2) and a carbonyl group (C=O) within the structure. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to its ability to form hydrogen bonds. Nonanediamide is primarily utilized in the synthesis of various polymers and as a building block in organic chemistry. Its properties include moderate melting and boiling points, which are influenced by the length of the carbon chain and the presence of functional groups. Additionally, nonanediamide can exhibit both hydrophilic and hydrophobic characteristics, making it versatile in applications such as surfactants and emulsifiers. Safety data indicates that, like many amides, it should be handled with care to avoid irritation to skin and eyes.

Formula: C₉H₁₈N₂O₂

InChI: InChI=1/C9H18N2O2/c10-8(12)6-4-2-1-3-5-7-9(11)13/h1-7H2,(H2,10,12)(H2,11,13)

InChI key: InChIKey=FJXWKBZRTWEWBJ-UHFFFAOYSA-N

SMILES: C(CC(N)=O)CCCCCC(N)=O

Synonyms:

• Nonanediamide
• Azelamide

Nonanediamide

CAS: 1842-72-4

Nonanediamide is a polyamide polymer with a hydroxyl group at each end. It is used in the manufacture of polymeric matrices for biomedical applications, such as sealants and adhesives. Nonanediamide has shown to be an effective sealant against water vapor, which may be due to its high resistance to hydrolysis. This chemical also facilitates the enzyme activities of thrombotic thrombocytopenic purpura (TTP) and hemolytic uremic syndrome (HUS). The amide bond that connects the monomer units together can be easily cleaved by enzymes, making it easier for blood cells to break down the polyamide polymer into smaller compounds.

Formula: C₉H₁₈N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 186.25 g/mol

Ref: 3D-BAA84272