
CAS 18427-44-6
:Parinaric acid
Description:
Parinaric acid is a polyunsaturated fatty acid characterized by its unique structure, which includes multiple double bonds in its carbon chain. Specifically, it is an 18-carbon fatty acid with four conjugated double bonds, making it a member of the class of fatty acids known as conjugated fatty acids. Its molecular formula is C18H30O2. Parinaric acid is typically found in certain plant oils and is of interest in various biochemical and nutritional studies due to its potential health benefits and roles in cellular processes. The presence of multiple double bonds contributes to its reactivity and influences its physical properties, such as melting point and solubility. Additionally, parinaric acid has been studied for its antioxidant properties and potential effects on lipid metabolism. Its CAS number, 18427-44-6, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, parinaric acid is significant in both research and potential applications in nutrition and health.
Formula:C18H28O2
InChI:InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-10H,2,11-17H2,1H3,(H,19,20)
InChI key:InChIKey=IJTNSXPMYKJZPR-UHFFFAOYSA-N
SMILES:C(CC=CC=CC=CC=CCC)CCCCCC(O)=O
Synonyms:- 9,11,13,15-Octadecatetraenoic acid
- Parinaric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
cis-Parinaric Acid
CAS:cis-Parinaric acid: natural fluorescent polyunsaturated fatty acid from inedible Makita seeds, used in lipid research.Formula:C18H28O2Color and Shape:SolidMolecular weight:276.42
