CAS 1843-21-6

N-PHENYL-1,3-BENZOTHIAZOL-2-AMINE

Description:

N-Phenyl-1,3-benzothiazol-2-amine, with the CAS number 1843-21-6, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features an amine group and a phenyl substituent, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit various physical properties such as color and solubility depending on the specific conditions. N-Phenyl-1,3-benzothiazol-2-amine is often studied for its potential use in organic synthesis, as a dye, or in the development of pharmaceuticals due to its biological activity. The presence of the thiazole moiety can impart unique electronic properties, making it of interest in materials science and medicinal chemistry. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken during its use in laboratory or industrial settings.

Formula: C₁₃H₁₀N₂S

InChI: InChI=1/C13H10N2S/c1-2-6-10(7-3-1)14-13-15-11-8-4-5-9-12(11)16-13/h1-9H,(H,14,15)

SMILES: c1ccc(cc1)N=c1[nH]c2ccccc2s1

Synonyms:

• 2-Benzothiazolamine, N-phenyl-

2,5-dimethoxy-2,5-dimethyl-2,5-dihydrofuran

CAS: 1843-21-6

Formula: C₁₃H₁₀N₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 226.2969

Ref: IN-DA007SBP

N-Phenyl-1,3-benzothiazol-2-amine

CAS: 1843-21-6

N-Phenyl-1,3-benzothiazol-2-amine

Purity: 95%

Molecular weight: 226.30g/mol

Ref: 54-OR480557

N-Phenyl-1,3-benzothiazol-2-amine

CAS: 1843-21-6

Purity: 95+%

Molecular weight: 226.3000030517578

Ref: 10-F651093

N-Phenyl-1,3-benzothiazol-2-amine

CAS: 1843-21-6

N-Phenyl-1,3-benzothiazol-2-amine is a synthetic aromatic compound that has been used as an antiviral agent. It inhibits the replication of RNA by binding to the carbon disulphide group in the ribose moiety of nucleosides. This prevents formation of the helix structure and stops synthesis of viral DNA. N-Phenyl-1,3-benzothiazol-2-amine is also active against influenza A virus and some other viruses. The molecular descriptors for this compound are nitrogen atoms (N), stabilization (S), cb1 receptor (Cb1) and virus activity (V). This substance is an active ingredient in many pharmaceuticals, such as cough syrup, pain relief tablets, and eye drops. It can be synthesized from copper oxide and chloride or introduced into a drug formulation by impurities.

Formula: C₁₃H₁₀N₂S

Purity: Min. 95%

Molecular weight: 226.3 g/mol

Ref: 3D-BAA84321