CAS 18430-74-5
:1-(3,5-DICHLORO-2-HYDROXYPHENYL)PROPAN-1-ONE
Description:
1-(3,5-Dichloro-2-hydroxyphenyl)propan-1-one, with the CAS number 18430-74-5, is an organic compound characterized by its structure, which includes a propanone moiety attached to a phenolic ring that is substituted with two chlorine atoms and a hydroxyl group. This compound typically exhibits properties associated with both ketones and phenolic compounds, such as potential reactivity in electrophilic substitution reactions due to the presence of the hydroxyl group and the electron-withdrawing effects of the chlorine substituents. It may also display moderate solubility in organic solvents and limited solubility in water, influenced by the hydrophobic nature of the chlorinated aromatic system. The presence of the dichloro and hydroxy groups can impart biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound's unique structural features contribute to its potential applications in various chemical and biological contexts.
Formula:C5H15MgNO8
InChI:InChI=1/C5H9NO4.Mg.4H2O/c6-3(5(9)10)1-2-4(7)8;;;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;4*1H2/q;+2;;;;/p-2/t3-;;;;;/m0...../s1
Synonyms:- 3',5'-Dichloro-2'-Hydroxypropiophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(3,5-Dichloro-2-hydroxyphenyl)-1-propanone
CAS:<p>1-(3,5-Dichloro-2-hydroxyphenyl)-1-propanone is a white crystalline solid that is stabilized by hydrogen bonds. Hydrazine acts as a stabilizer to keep the molecule in its solid state. It is used as an intermediate in the synthesis of other chemicals and pharmaceuticals. 1-(3,5-Dichloro-2-hydroxyphenyl)-1-propanone has been shown to form crystals with a monoclinic system, space group C2/c, with unit cell dimensions of b = 11.817(7) Å, c = 15.859(10) Å, α = 90°, β = 105.906(4)°, γ = 90°, V = 791.6(3) Å3, Z=4 and Dcalcd=1.629 g cm−3.</p>Formula:C9H8Cl2O2Purity:Min. 95%Molecular weight:219.06 g/mol
