CAS 184346-45-0
:(S)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone
Description:
(S)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone is a chiral oxazolidinone compound characterized by its unique structural features, including an isopropyl group and two phenyl substituents on the oxazolidinone ring. This compound is typically used in organic synthesis and pharmaceutical applications due to its potential as a chiral auxiliary or building block in the synthesis of biologically active molecules. The presence of the oxazolidinone moiety contributes to its stability and reactivity, making it a valuable intermediate in various chemical reactions. The stereochemistry indicated by the (S) designation suggests that it possesses specific optical activity, which can influence its interactions in biological systems. Additionally, the compound's solubility and reactivity can vary depending on the solvent and conditions used in reactions. Overall, (S)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone exemplifies the importance of chirality in organic chemistry and its applications in drug development and synthesis.
Formula:C18H19NO2
InChI:InChI=1/C18H19NO2/c1-13(2)16-18(21-17(20)19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,1-2H3,(H,19,20)/t16-/m0/s1
SMILES:CC(C)[C@H]1C(c2ccccc2)(c2ccccc2)OC(=N1)O
Synonyms:- (4S)-4-(1-methylethyl)-5,5-diphenyl-1,3-oxazolidin-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-4-Isopropyl-5,5-diphenyloxazolidin-2-one
CAS:Purity:97%Color and Shape:SolidMolecular weight:281.141578848(4S)-(-)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone
CAS:Formula:C18H19NO2Purity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:281.36(S)-4-Isopropyl-5,5-diphenyloxazolidin-2-one
CAS:Formula:C18H19NO2Purity:97%Color and Shape:SolidMolecular weight:281.3490(S)-(-)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone
CAS:(S)-(-)-4-Isopropyl-5,5-diphenyl-2-oxazolidinonePurity:99%Molecular weight:281.35g/mol(S)-4-Isopropyl-5,5-diphenyloxazolidin-2-one
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:281.3550109863281(4S)-(-)-4-Isopropyl-5,5-diphenyl-2-oxazolidinone
CAS:<p>Isopropylmagnesium bromide is a tertiary alcohol that can be used to prepare an enantiospecific, catalytic system for the oxidative carbonylation of methyl ester and the oxidative cyclocarbonylation of tert-butyl ester. Isopropylmagnesium bromide reacts with carbamic acid in a two-step process. The first step involves nucleophilic attack by the magnesium ion on the carbamic acid, followed by displacement of the tert-butyl group from the product. The second step is when a molecule of water reacts with magnesium to form magnesium hydroxide and release hydrogen gas.</p>Formula:C18H19NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:281.35 g/mol




