CAS 18436-73-2

4-Chloro-8-methylquinoline

Description:

4-Chloro-8-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that consists of a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 4-position and a methyl group at the 8-position of the quinoline structure, which influences its chemical properties and reactivity. It is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of the chlorine atom can impart unique electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. 4-Chloro-8-methylquinoline may exhibit biological activity, which has led to its investigation in medicinal chemistry, particularly for its potential as an antimicrobial or antitumor agent. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₀H₈ClN

InChI: InChI=1/C10H8ClN/c1-7-3-2-4-8-9(11)5-6-12-10(7)8/h2-6H,1H3

SMILES: Cc1cccc2c(ccnc12)Cl

4-Chloro-8-methylquinoline

CAS: 18436-73-2

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₀H₈ClN

Molecular weight: 177.63

Ref: 02-H50201

4-Chloro-8-methylquinoline

CAS: 18436-73-2

Formula: C₁₀H₈ClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 177.6302

Ref: IN-DA0075G1

4-Chloro-8-methylquinoline

CAS: 18436-73-2

4-Chloro-8-methylquinoline

Formula: C₁₀H₈ClN

Purity: 97%

Color and Shape: grey solid

Molecular weight: 177.63g/mol

Ref: 54-OR3637

4-Chloro-8-methylquinoline

CAS: 18436-73-2

Purity: 98%

Molecular weight: 177.6300049

Ref: 10-F692719