CAS 18436-76-5
:4-CHLORO-7-NITROQUINOLINE
Description:
4-Chloro-7-nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a chlorine atom at the 4-position and a nitro group at the 7-position of the quinoline ring, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, and its molecular formula reflects the presence of chlorine, nitrogen, and carbon atoms, indicating potential for various chemical reactivity. The presence of the nitro group can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. 4-Chloro-7-nitroquinoline has applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its biological activity against certain pathogens. Additionally, it may serve as an intermediate in the synthesis of other complex organic molecules. As with many chemical substances, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C9H5ClN2O2
InChI:InChI=1S/C9H5ClN2O2/c10-8-3-4-11-9-5-6(12(13)14)1-2-7(8)9/h1-5H
InChI key:UPZGWWDLHRREJM-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CN=C2C=C1[N+](=O)[O-])Cl
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-CHLORO-7-NITROQUINOLINE
CAS:Formula:C9H5ClN2O2Purity:97%Color and Shape:SolidMolecular weight:208.64-Chloro-7-nitroquinoline
CAS:4-Chloro-7-nitroquinolineFormula:C9H5ClN2O2Purity:97%Molecular weight:208.64-Chloro-7-nitroquinoline
CAS:Formula:C9H5ClN2O2Purity:97%Color and Shape:SolidMolecular weight:208.60124-Chloro-7-nitroquinoline
CAS:4-Chloro-7-nitroquinolineFormula:C9H5ClN2O2Purity:97%Molecular weight:208.64-Chloro-7-nitroquinoline
CAS:4-Chloro-7-nitroquinoline is an aromatic compound that is synthesized from the chlorination of quinoline derivatives. It has been shown to have a high uptake in tissues and has been used for the preparation of other compounds. 4-Chloro-7-nitroquinoline has also been used as a molecular probe for the study of vacuoles, which are intracellular compartments that store water, sugars, and ions. The molecule can be made isotopically labeled by replacing one of its hydrogen atoms with deuterium, which can be used to diagnose disorders.
Formula:C9H5ClN2O2Purity:Min. 95%Molecular weight:208.6 g/mol




