CAS 184416-84-0
:2,3-Dichloro-4-pyridinecarboxylic acid
Description:
2,3-Dichloro-4-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 2 and 3 positions with chlorine atoms and at the 4 position with a carboxylic acid group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The dichloro substitutions can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,3-Dichloro-4-pyridinecarboxylic acid is a versatile compound with applications in synthetic organic chemistry and material science.
Formula:C6H3Cl2NO2
InChI:InChI=1/C6H3Cl2NO2/c7-4-3(6(10)11)1-2-9-5(4)8/h1-2H,(H,10,11)
SMILES:c1cnc(c(c1C(=O)O)Cl)Cl
Synonyms:- 2,3-Dichloro Pyridine-4-Carboxylic Acid
- 2,3-Dichloropyridine-4-Carboxylic Acid
- 2,3-Dichloroisonicotinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Dichloropyridine-4-carboxylic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H3Cl2NO2Purity:97%Molecular weight:192.002,3-Dichloropyridine-4-carboxylic acid
CAS:Formula:C6H3Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:191.99952,3-Dichloroisonicotinic acid
CAS:2,3-Dichloroisonicotinic acidFormula:C6H3Cl2NO2Purity:≥95%Color and Shape:SolidMolecular weight:192.00g/mol2,3-Dichloropyridine-4-carboxylic acid
CAS:Formula:C6H3Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:192





