CAS 184475-71-6
:4-(3-chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ol
Description:
4-(3-Chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ol is a chemical compound characterized by its complex structure, which includes a quinazoline core substituted with various functional groups. The presence of a chloro and a fluoro group on the phenyl ring contributes to its unique reactivity and potential biological activity. The methoxy group at the 7-position of the quinazoline enhances its solubility and may influence its pharmacological properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure suggests it may exhibit properties such as anti-cancer or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Additionally, the compound's stability, solubility, and interaction with biological systems are critical factors that influence its utility in research and therapeutic contexts. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C15H11ClFN3O2
InChI:InChI=1/C15H11ClFN3O2/c1-22-14-6-12-9(5-13(14)21)15(19-7-18-12)20-8-2-3-11(17)10(16)4-8/h2-7,21H,1H3,(H,18,19,20)
SMILES:COc1cc2c(cc1O)c(ncn2)Nc1ccc(c(c1)Cl)F
Synonyms:- 4-(3-Chloro-4-fluorophenylamino)-6-hydroxy-7-methoxyquinazoline
- 4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinol
- O-Desmorpholinopropyl Gefitinib
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
4-(3-Chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ol
CAS:Formula:C15H11ClFN3O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:319.72FAAH-IN-2
CAS:<p>FAAH-IN-2 (O-Desmorpholinopropyl Gefitinib) is a potent inhibitor of FAAH(fatty acid amide hydrolase).</p>Formula:C15H11ClFN3O2Purity:99.18%Color and Shape:Tan SolidMolecular weight:319.724-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolino
CAS:Formula:C15H11ClFN3O2Purity:98%Color and Shape:SolidMolecular weight:319.7181Gefitinib Impurity 12 (O-Desmorpholinopropyl Gefitinib)
CAS:Formula:C15H11ClFN3O2Color and Shape:Pale Brown SolidMolecular weight:319.734-[(3-Chloro-4-fluorophenyl)amino]-7-methoxyquinazolin-6-ol (O-Desmorpholinopropylgefitinib)
CAS:Color and Shape:Neat4-((3-Chloro-4-fluorophenyl)amino)-7-methoxyquinazolin-6-ol
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:319.7200012207031O-Desmorpholinopropyl Gefitinib
CAS:<p>Applications A metabolite of Gefitinib.<br>References Ranson, M., et al.: J. Clin. Oncology, 20, 2240 (2002); Mendelsohn, J., et al.: J. Clin. Oncology, 21, 2787 (2003); McKillop, D., et al.: Xenobiotica, 10, 917 (2004);<br></p>Formula:C15H11ClFN3O2Color and Shape:NeatMolecular weight:319.72O-Desmorpholinopropyl gefitinib
CAS:<p>O-Desmorpholinopropyl gefitinib is a crystalline chemical compound with a propanol molecule that has been bound to the phenol group of gefitinib. The ligand is an organic compound that is able to bind to a metal ion, such as chloride, and form a stable complex. This compound has shown promise as a potential treatment for cancer because it can inhibit the activity of enzymes involved in the synthesis of DNA. The sponge crystal structure was obtained by X-ray diffraction studies and revealed that this compound is hydrophilic in nature. A study measuring the parameters of radiation showed that when exposed to radiation, O-Desmorpholinopropyl gefitinib emits light with wavelengths of approximately 940 nm.</p>Formula:C15H11ClFN3O2Purity:Min. 95%Molecular weight:319.72 g/mol









