
CAS 18455-25-9
:2-Amino-3,6-anhydro-2,4,5,7-tetradeoxy-L-xylo-hept-4-enonic acid
Description:
2-Amino-3,6-anhydro-2,4,5,7-tetradeoxy-L-xylo-hept-4-enonic acid, with the CAS number 18455-25-9, is a complex organic compound characterized by its unique structural features, including an amino group and an anhydro sugar moiety. This compound is part of the family of amino sugars and is notable for its role in biochemical processes, particularly in the context of bacterial cell wall synthesis and as a potential precursor in the synthesis of various bioactive molecules. Its structure includes a heptose backbone with specific stereochemistry that contributes to its biological activity. The presence of the double bond in the hept-4-enonic acid portion suggests potential reactivity, making it a candidate for further chemical modifications. Additionally, this compound may exhibit specific solubility characteristics in polar solvents due to its functional groups. Overall, 2-Amino-3,6-anhydro-2,4,5,7-tetradeoxy-L-xylo-hept-4-enonic acid is of interest in both synthetic organic chemistry and medicinal chemistry for its potential applications.
Formula:C7H11NO3
InChI:InChI=1S/C7H11NO3/c1-4-2-3-5(11-4)6(8)7(9)10/h2-6H,8H2,1H3,(H,9,10)/t4-,5+,6-/m0/s1
InChI key:InChIKey=PNOKUGWGMLEAPE-JKUQZMGJSA-N
SMILES:[C@H](C(O)=O)(N)[C@]1(C=C[C@H](C)O1)[H]
Synonyms:- 2-Furanacetic acid, α-amino-2,5-dihydro-5-methyl-, (+)-
- (+)-Furanomycin
- Furanomycin
- 2-Amino-3,6-anhydro-2,4,5,7-tetradeoxy-L-xylo-hept-4-enonic acid
- L-xylo-Hept-4-enonic acid, 2-amino-3,6-anhydro-2,4,5,7-tetradeoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Furanomycin
CAS:Furanomycin is an analog of isoleucine.Formula:C7H11NO3Color and Shape:SolidMolecular weight:157.17
