CAS 18455-98-6
:(-)-Bakkenolide B
Description:
(-)-Bakkenolide B is a naturally occurring sesquiterpene lactone, primarily derived from the plant species of the genus *Artemisia*. It is characterized by its unique bicyclic structure, which contributes to its biological activity. The compound exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. (-)-Bakkenolide B is typically found in essential oils and extracts from certain plants, and its stereochemistry plays a crucial role in its biological interactions. The compound is soluble in organic solvents, and its stability can be influenced by environmental factors such as light and temperature. As with many natural products, the extraction and purification processes are essential for obtaining this compound in a usable form for research and potential therapeutic applications. Overall, (-)-Bakkenolide B represents a significant area of study within the field of natural product chemistry due to its diverse biological activities and potential health benefits.
Formula:C22H30O6
InChI:InChI=1S/C22H30O6/c1-7-12(2)19(24)28-16-9-8-13(3)21(6)11-22(14(4)10-26-20(22)25)18(17(16)21)27-15(5)23/h7,13,16-18H,4,8-11H2,1-3,5-6H3/b12-7-/t13-,16-,17+,18+,21+,22+/m0/s1
InChI key:InChIKey=AVAGQVZSHJYDED-RRIKAWJQSA-N
SMILES:O(C(C)=O)[C@H]1[C@@]2(C[C@@]3(C)[C@@]1([C@@H](OC(/C(=C\C)/C)=O)CC[C@@H]3C)[H])C(=C)COC2=O
Synonyms:- 2-Butenoic acid, 2-methyl-, 3′-(acetyloxy)decahydro-7′,7′a-dimethyl-4-methylene-2-oxospiro[furan-3(2H),2′-[2H]inden]-4′-yl ester, [2′R-[2′α,3′α,3′aα,4′β(Z),7′α,7′aα]]-
- Spiro[furan-3(2H),2′-indan]-2-one, octahydro-1′,7′-dihydroxy-3′a,4′-dimethyl-4-methylene-, 1′-acetate 2-methylcrotonate, (Z)-
- 2-Butenoic acid, 2-methyl-, (2′R,3′R,3′aR,4′S,7′S,7′aR)-3′-(acetyloxy)decahydro-7′,7′a-dimethyl-4-methylene-2-oxospiro[furan-3(2H),2′-[2H]inden]-4′-yl ester, (2Z)-
- Crotonic acid, 2-methyl-, 7′-ester with 3′a,4,4′,5,5′,6′,7′,7′aβ-octahydro-1′β,7′α-dihydroxy-3′aβ,4′β-dimethyl-4-methylenespiro[furan-3(2H),2′-indan]-2-one acetate, (Z)-
- Bakkenolide B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bakkenolide B
CAS:Bakkenolide B has suppressive properties for allergic and inflammatory responses and may be utilized as a potent agent for the treatment of asthma.Formula:C22H30O6Purity:98%Color and Shape:SolidMolecular weight:390.47Fukinolide
CAS:Fukinolide is a bioactive compound that is isolated from marine algae, specifically from the genus *Sargassum*. This compound is known for its complex chemical structure, which includes a variety of functional groups contributing to its biological activity. Fukinolide's mode of action involves the modulation of specific cellular pathways, including those related to oxidative stress and inflammation. This makes it a candidate for further research in therapeutic contexts.Formula:C22H30O6Purity:Min. 95%Molecular weight:390.5 g/mol


