CAS 18457-04-0
:Propanedioic acid, 1,3-bis(trimethylsilyl) ester
Description:
Propanedioic acid, 1,3-bis(trimethylsilyl) ester, also known as dimethyl 1,3-bis(trimethylsilyl) ester, is an organosilicon compound characterized by the presence of two trimethylsilyl groups attached to a propanedioic acid backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its stability and low volatility. It is soluble in organic solvents such as dichloromethane and ether, but insoluble in water due to its hydrophobic trimethylsilyl groups. The presence of these silyl groups enhances its reactivity in various chemical transformations, making it useful as a protecting group in organic synthesis, particularly in the protection of carboxylic acids and alcohols. Additionally, the compound can undergo hydrolysis to regenerate the parent acid under appropriate conditions. Its applications extend to the fields of organic chemistry and materials science, where it may serve as a precursor for the synthesis of more complex siloxane compounds. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H20O4Si2
InChI:InChI=1S/C9H20O4Si2/c1-14(2,3)12-8(10)7-9(11)13-15(4,5)6/h7H2,1-6H3
InChI key:InChIKey=ATCKJLDGNXGLAO-UHFFFAOYSA-N
SMILES:O([Si](C)(C)C)C(CC(O[Si](C)(C)C)=O)=O
Synonyms:- Malonic acid bis(trimethylsilyl) ester
- Octadecylsilane
- Propanedioic acid, 1,3-bis(trimethylsilyl) ester
- Propanedioic acid, bis(trimethylsilyl) ester
- Silanol, trimethyl-, malonate (2:1)
- Bis(trimethylsilyl) malonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bis(trimethylsilyl) Malonate
CAS:Formula:C9H20O4Si2Purity:>97.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:248.43Bis(trimethylsilyl) malonate
CAS:Formula:C9H20O4Si2Purity:96%Color and Shape:LiquidMolecular weight:248.4237Bis(trimethylsilyl)malonate
CAS:Bis(trimethylsilyl)malonate is a molecule that is used as a reagent in organic chemistry. It is an ethyl ester of malonic acid and can be synthesized using phosphorus pentoxide and the methyl ketones. The synthesis of covid-19, a pandemic antiviral drug, requires this chemical. Covid-19 has been shown to have anticancer activity in animal studies, as well as clinical chemistry applications for colorectal carcinoma.Formula:C9H20O4Si2Purity:Min. 95%Color and Shape:Colourless To Yellow LiquidMolecular weight:248.42 g/molBis(trimethylsilyl) malonate
CAS:Formula:C9H20O4Si2Purity:96% GCColor and Shape:Liquid, ClearMolecular weight:248.425




