CAS 18463-11-1
:RHIZOCARPIC ACID
Description:
Rhizocarpic acid, with the CAS number 18463-11-1, is a naturally occurring organic compound classified as a fatty acid. It is primarily derived from certain species of plants, particularly those in the Rhizocarpus genus. This compound is characterized by its unique structure, which includes a long hydrocarbon chain and a carboxylic acid functional group, contributing to its amphipathic properties. Rhizocarpic acid is known for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in various fields such as pharmacology and agriculture. Additionally, it may play a role in plant physiology, particularly in the regulation of growth and development. The compound is typically found in low concentrations in plant tissues and can be extracted for research purposes. Its solubility characteristics can vary, influencing its behavior in different environments. Overall, rhizocarpic acid represents a fascinating subject of study due to its natural origins and potential applications in science and industry.
Formula:C28H23NO6
InChI:InChI=1/C28H23NO6/c1-34-27(32)21(17-18-11-5-2-6-12-18)29-26(31)23(20-15-9-4-10-16-20)25-24(30)22(28(33)35-25)19-13-7-3-8-14-19/h2-16,21,33H,17H2,1H3,(H,29,31)/b25-23+/t21-/m0/s1
Synonyms:- Alanine, N-((3-hydroxy-5-oxo-4-phenyl-2(5H)-furylidene)phenylacetyl)-3-phenyl-, methyl ester, L-
- L-Phenylalanine, N-((3-hydroxy-5-oxo-4-phenyl-2(5H)-furanylidene)phenylacetyl)-, methyl ester
- methyl N-[(2E)-2-(5-hydroxy-3-oxo-4-phenylfuran-2(3H)-ylidene)-2-phenylacetyl]-L-phenylalaninate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Rhizocarpic acid
CAS:Rhizocarpic acid is a derivative of shikimic acid.Formula:C28H23NO6Color and Shape:SolidMolecular weight:469.49Rhizocarpic acid
CAS:Rhizocarpic acid is a naturally occurring organic compound that belongs to the group of polyhydroxy acids. It is a light-sensitive, acidic compound with a hydroxyl group and a multidrug efflux pump. Rhizocarpic acid has been shown to have metabolic profiles that are similar to those of other polyhydroxylated compounds and it is thought to be an intermediate in the biosynthesis of usnic acid. Rhizocarpic acid can be used as a low-light photosynthetic activator for plants, because it enhances their photosynthetic activity under conditions where light intensity is not high enough for photosynthesis. The FT-IR spectroscopy data indicates that rhizocarpic acid has three carbonyl groups in its structure and these groups are responsible for its acidic nature.Formula:C28H23NO6Purity:Min. 95%Molecular weight:469.49 g/mol

