CAS 18463-25-7
:4-hydroxy-2-(hydroxymethyl)phenyl 6-O-(phenylcarbonyl)-beta-D-glucopyranoside
Description:
4-Hydroxy-2-(hydroxymethyl)phenyl 6-O-(phenylcarbonyl)-beta-D-glucopyranoside, with the CAS number 18463-25-7, is a glycoside compound characterized by the presence of a glucopyranoside moiety linked to a phenolic structure. This compound features a hydroxymethyl group and a hydroxy group on the aromatic ring, contributing to its potential biological activity. The phenylcarbonyl group attached to the glucopyranoside enhances its lipophilicity and may influence its interaction with biological targets. Glycosides like this one often exhibit various pharmacological properties, including antioxidant and anti-inflammatory activities, due to the presence of the phenolic component. The glucopyranoside structure can also affect solubility and stability in biological systems. Overall, this compound is of interest in medicinal chemistry and natural product research, particularly for its potential therapeutic applications. Further studies would be necessary to fully elucidate its biological effects and mechanisms of action.
Formula:C20H22O9
InChI:InChI=1/C20H22O9/c21-9-12-8-13(22)6-7-14(12)28-20-18(25)17(24)16(23)15(29-20)10-27-19(26)11-4-2-1-3-5-11/h1-8,15-18,20-25H,9-10H2/t15-,16-,17+,18-,20-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Nigracin
CAS:Nigracin is a natural product for research related to life sciences. The catalog number is TN4656 and the CAS number is 18463-25-7.Formula:C20H22O9Purity:98%Color and Shape:SolidMolecular weight:406.38Nigracin
CAS:Nigracin is a specialty antifungal agent derived from bacterial sources. It is synthesized by specific strains of Streptomyces, a genus of Gram-positive bacteria renowned for producing pharmacologically active compounds. Nigracin functions by disrupting the integrity of fungal cell membranes. This is achieved through the compound's interaction with ergosterol, a key component in fungal cell membranes, leading to increased permeability and ultimately, cell lysis.Formula:C20H22O9Purity:Min. 95%Molecular weight:406.4 g/mol




