
CAS 184637-63-6
:Glycine, N-(4-fluorophenyl)-, monopotassium salt
Description:
Glycine, N-(4-fluorophenyl)-, monopotassium salt is a chemical compound that belongs to the class of amino acids and their derivatives. It is characterized by the presence of a glycine moiety, which is the simplest amino acid, combined with a 4-fluorophenyl group, indicating the substitution of a fluorine atom on the phenyl ring. This compound is typically a white to off-white solid and is soluble in water due to the presence of the potassium salt, which enhances its solubility compared to its neutral form. The presence of the fluorine atom can influence the compound's biological activity and properties, making it of interest in pharmaceutical and biochemical research. Its structure allows it to participate in various chemical reactions, and it may exhibit specific interactions with biological targets, potentially serving as a building block in drug development. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C8H8FNO2·K
InChI:InChI=1S/C8H8FNO2.K/c9-6-1-3-7(4-2-6)10-5-8(11)12;/h1-4,10H,5H2,(H,11,12);
InChI key:InChIKey=NTTBTQNZFMMCCG-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C1=CC=C(F)C=C1.[K]
Synonyms:- Glycine, N-(4-fluorophenyl)-, monopotassium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Potassium 4-fluorophenyl glycinate
CAS:Potassium 4-fluorophenyl glycinate is a compound that has the potential for use as a building block in organic synthesis. It can be used as an intermediate in the synthesis of various other compounds, and is also useful as a reagent in organic reactions. Potassium 4-fluorophenyl glycinate is also used in research to develop new therapeutic agents. This compound has a number of applications, including being used as a building block for pharmaceuticals, agrochemicals, and specialty chemicals.Formula:C8H8FNO2•KPurity:Min. 90%Color and Shape:PowderMolecular weight:208.25 g/mol
