CymitQuimica logo

CAS 184639-68-7

:

Tetradecanoic acid, 14-mercapto-

Description:
Tetradecanoic acid, 14-mercapto- is a chemical compound characterized by its long-chain fatty acid structure, specifically a 14-carbon chain with a thiol (-SH) functional group at the terminal position. This compound is part of the fatty acid family and is known for its hydrophobic properties due to the long hydrocarbon chain, while the thiol group introduces unique reactivity and potential for forming disulfide bonds. The presence of the mercapto group enhances its utility in various applications, including bioconjugation and as a building block in organic synthesis. Tetradecanoic acid, 14-mercapto- may exhibit properties typical of fatty acids, such as being solid at room temperature and having a relatively high melting point compared to shorter-chain fatty acids. Its CAS number, 184639-68-7, allows for precise identification in chemical databases and regulatory contexts. Overall, this compound's unique structure makes it of interest in both industrial and research settings, particularly in the fields of materials science and biochemistry.
Formula:C14H28O2S
InChI:InChI=1S/C14H28O2S/c15-14(16)12-10-8-6-4-2-1-3-5-7-9-11-13-17/h17H,1-13H2,(H,15,16)
InChI key:VPORVJHUQAFEIX-UHFFFAOYSA-N
SMILES:C(CCCCCCC(=O)O)CCCCCCS
Found 6 products.