CAS 18465-50-4

4,6-O-Ethylidene-D-glucopyranose

Description:

4,6-O-Ethylidene-D-glucopyranose is a carbohydrate derivative, specifically a modified form of D-glucose. It features an ethylidene group at the 4 and 6 positions of the glucopyranose ring, which alters its reactivity and solubility compared to unmodified glucose. This compound is typically a white to off-white crystalline solid, exhibiting hygroscopic properties, meaning it can absorb moisture from the air. It is soluble in water and polar organic solvents, making it useful in various chemical applications, including as a building block in organic synthesis and in carbohydrate chemistry. The presence of the ethylidene group can influence its interaction with enzymes and other biological molecules, potentially affecting its metabolic pathways. Additionally, 4,6-O-Ethylidene-D-glucopyranose can serve as a protective group in glycosylation reactions, facilitating the synthesis of more complex carbohydrates. Its stability and reactivity are influenced by the specific conditions under which it is used, including pH and temperature. Overall, this compound is significant in both synthetic organic chemistry and biochemistry.

Formula: C₈H₁₄O₆

InChI: InChI=1/C8H14O6/c1-3-12-2-4-7(13-3)5(9)6(10)8(11)14-4/h3-11H,2H2,1H3/t3?,4-,5-,6-,7-,8?/m1/s1

SMILES: CC1OC[C@@H]2[C@H]([C@@H]([C@H](C(O)O2)O)O)O1

Synonyms:

• 4,6-O-Ethylidene-D-glucopyranoside
• (1R,2S,3R,6R)-9-methyl-5,8,10-trioxabicyclo[4.4.0]decane-2,3,4-triol

(4AR,7R,8R,8aS)-2-methylhexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol

CAS: 18465-50-4

(4AR,7R,8R,8aS)-2-methylhexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol

Purity: 98%

Molecular weight: 206.19g/mol

Ref: 54-OR1035807

4,6-O-Ethylidene-D-glucopyranose

CAS: 18465-50-4

4, 6-O-Ethylidene-D-glucopyranose is a glucose analogue that inhibits sugar transport. It has been shown to inhibit glucose transport by binding to the hydroxyl group on the red cell membrane. This binding prevents the sugar from entering the cell and as a result, glucose accumulates in the blood. 4, 6-O-Ethylidene-D-glucopyranose also binds to tryptophan fluorescence and inhibits cytochalasin B binding to tryptophans that are located on the plasma membrane of eukaryotic cells.

Formula: C₈H₁₄O₆

Purity: Min. 90 Area-%

Color and Shape: Powder

Molecular weight: 206.19 g/mol

Ref: 3D-ME05032

(4AR,7R,8R,8aS)-2-methylhexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol

CAS: 18465-50-4

Purity: 98%

Molecular weight: 206.08

Ref: 10-F552881