CAS 18469-37-9

4-Bromo-N,N-dimethylbenzamide

Description:

4-Bromo-N,N-dimethylbenzamide is an organic compound characterized by the presence of a bromine atom attached to the para position of a benzamide structure. Its molecular formula is C10H12BrN, indicating it contains a benzene ring substituted with a bromine atom and a dimethylamide group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethanol, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, including medicinal chemistry and material science. Additionally, the dimethylamide group contributes to its basicity and potential interactions in biological systems. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in laboratory settings.

Formula: C₉H₁₀BrNO

InChI: InChI=1/C9H10BrNO/c1-11(2)9(12)7-3-5-8(10)6-4-7/h3-6H,1-2H3

SMILES: CN(C)C(=O)c1ccc(cc1)Br

Synonyms:

• N,N-Dimethyl 4-bromobenzamide

N,N-Dimethyl 4-bromobenzamide

CAS: 18469-37-9

Formula: C₉H₁₀BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.0858

Ref: IN-DA007S0I

4-Bromo-N,N-dimethylbenzamide

CAS: 18469-37-9

4-Bromo-N,N-dimethylbenzamide

Formula: C₉H₁₀BrNO

Purity: 98%

Color and Shape: off white solid

Molecular weight: 228.08579g/mol

Ref: 54-OR11624

4-Bromo-N,N-dimethylbenzamide

CAS: 18469-37-9

Formula: C₉H₁₀BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.089

Ref: 10-F080305