CAS 18469-52-8

Methyl 4-(aminomethyl)benzoate

Description:

Methyl 4-(aminomethyl)benzoate, with the CAS number 18469-52-8, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, specifically with an amino group at the para position relative to the ester. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic ring. The presence of the amino group introduces basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Methyl 4-(aminomethyl)benzoate can be utilized in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds, making it valuable in medicinal chemistry and material science. Additionally, it may exhibit biological activity, which can be explored for potential applications in drug development. Proper handling and safety measures should be observed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₉H₁₂ClNO₂

InChI: InChI=1/C9H11NO2.ClH/c1-12-9(11)8-4-2-7(6-10)3-5-8;/h2-5H,6,10H2,1H3;1H

SMILES: COC(=O)c1ccc(cc1)CN.Cl

Synonyms:

• 4-Aminomethylbenzoic acid methyl ester

methyl 4-(aminomethyl)benzoate

CAS: 18469-52-8

Formula: C₉H₁₁NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 165.1891

Ref: IN-DA00APIV

Methyl 4-(aminomethyl)benzoate

CAS: 18469-52-8

Purity: 98%

Molecular weight: 165.19

Ref: 10-F788077