CAS 18480-23-4
:Phosphonium, triphenyl-2-propen-1-yl-, chloride (1:1)
Description:
Phosphonium, triphenyl-2-propen-1-yl-, chloride (1:1) is an organic compound characterized by the presence of a phosphonium cation and a chloride anion. The phosphonium cation features a central phosphorus atom bonded to three phenyl groups and one 2-propen-1-yl group, which contributes to its unique reactivity and properties. This compound typically appears as a solid or crystalline material and is soluble in organic solvents. Its structure allows for potential applications in organic synthesis, particularly in reactions involving nucleophilic substitution or as a phase transfer catalyst. The presence of the triphenyl group enhances its stability and can influence its electronic properties, making it useful in various chemical transformations. Additionally, the chloride ion serves as a counterion, balancing the positive charge of the phosphonium cation. Safety data should be consulted for handling, as with many organophosphorus compounds, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse chemistry associated with phosphonium salts.
Formula:C21H20ClP
InChI:InChI=1/C21H20P.ClH/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h2-17H,1,18H2;1H/q+1;/p-1
InChI key:InChIKey=FKMJROWWQOJRJX-UHFFFAOYSA-M
SMILES:[P+](CC=C)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
Synonyms:- Allyl Triphenylphosphonium Chloride
- Nsc 126440
- Phosphonium, allyltriphenyl-, chloride
- Phosphonium, triphenyl-2-propen-1-yl-, chloride (1:1)
- Phosphonium, triphenyl-2-propenyl-, chloride
- Triphenyl(Prop-2-En-1-Yl)Phosphonium Chloride
- Allyltriphenylphosphonium chloride
- Ally triphenyl phosphonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Allyltriphenylphosphonium chloride, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C21H20ClPPurity:99%Color and Shape:Powder, White to pale creamMolecular weight:338.81Allyltriphenylphosphonium chloride
CAS:Formula:C21H20ClPPurity:98%Color and Shape:SolidMolecular weight:338.8103allyl(triphenyl)phosphonium chloride
CAS:allyl(triphenyl)phosphonium chloridePurity:98%Molecular weight:338.81026g/mol




