CAS 1848233-59-9

1,1-Dimethylethyl 3-phenyl-4-[[4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-1-yl]carbonyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 3-phenyl-4-[[4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-1-yl]carbonyl]-1-piperazinecarboxylate, with the CAS number 1848233-59-9, is a complex organic compound characterized by its multi-functional structure. It features a piperazine ring, which is known for its biological activity, and incorporates a triazole moiety that is often associated with pharmaceutical applications due to its ability to form stable complexes with metal ions and its role in various biological processes. The presence of a trifluoromethoxy group enhances its lipophilicity and may influence its pharmacokinetic properties. Additionally, the compound exhibits potential as a bioactive agent, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its properties can be assessed through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound represents a significant example of modern synthetic chemistry with potential applications in therapeutic contexts.

Formula: C₂₅H₂₆F₃N₅O₄

InChI: InChI=1S/C25H26F3N5O4/c1-24(2,3)37-23(35)31-13-14-32(21(16-31)18-7-5-4-6-8-18)22(34)33-15-20(29-30-33)17-9-11-19(12-10-17)36-25(26,27)28/h4-12,15,21H,13-14,16H2,1-3H3

InChI key: InChIKey=MCQNBNJCBIKELG-UHFFFAOYSA-N

SMILES: C(=O)(N1C(CN(C(OC(C)(C)C)=O)CC1)C2=CC=CC=C2)N3C=C(N=N3)C4=CC=C(OC(F)(F)F)C=C4

Synonyms:

• 1,1-Dimethylethyl 3-phenyl-4-[[4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-1-yl]carbonyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 3-phenyl-4-[[4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-1-yl]carbonyl]-, 1,1-dimethylethyl ester

DO53

CAS: 1848233-59-9

DO53 is a negative control for DO34, not inhibiting DAGL.

Formula: C₂₅H₂₆F₃N₅O₄

Color and Shape: Solid

Molecular weight: 517.50

Ref: TM-T31558

3-Phenyl-4-[[4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-1-yl]carbonyl]-1-piperazinecarboxylic acid 1,1-dimethylethyl ester

CAS: 1848233-59-9

3-Phenyl-4-[[4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-1-yl]carbonyl]-1-piperazinecarboxylic acid 1,1-dimethylethyl ester is a research tool. It is used to activate the receptor and study the effect on ion channels. This ligand has been shown to have agonist and antagonist effects on different ion channel receptors. 3-Phenyl-4-[(4-[4-(trifluoromethoxy)phenyl]-1H-1,2,3-triazol-- 1-yl)carbonyl]-1piperazinecarboxylic acid 1,1dimethylethyl ester has been used as a ligand in receptor binding studies with cell cultures that are responsive to protein interactions. It has also been shown to be an inhibitor of

Formula: C₂₅H₂₆F₃N₅O₄

Purity: Min. 95%

Molecular weight: 517.5 g/mol

Ref: 3D-YYC23359