CAS 184845-43-0
:1-[3-(9H-carbazol-9-yl)propyl]-4-(2-methoxyphenyl)piperidin-4-ol hydrochloride (1:1)
Description:
1-[3-(9H-carbazol-9-yl)propyl]-4-(2-methoxyphenyl)piperidin-4-ol hydrochloride is a synthetic compound characterized by its complex structure, which includes a piperidine ring, a carbazole moiety, and a methoxyphenyl group. This compound typically exhibits properties associated with its piperidine core, such as potential psychoactive effects and interactions with neurotransmitter systems. The presence of the carbazole structure may contribute to its photophysical properties and potential applications in organic electronics or as a fluorescent probe. The hydrochloride salt form enhances its solubility in aqueous solutions, making it suitable for biological studies. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic components. As with many compounds of this nature, it is essential to consider its pharmacological profile, including potential therapeutic effects and side effects, as well as its stability and reactivity under various conditions. Further research is often necessary to fully elucidate its biological activity and potential applications in medicinal chemistry.
Formula:C27H31ClN2O2
InChI:InChI=1/C27H30N2O2.ClH/c1-31-26-14-7-4-11-23(26)27(30)15-19-28(20-16-27)17-8-18-29-24-12-5-2-9-21(24)22-10-3-6-13-25(22)29;/h2-7,9-14,30H,8,15-20H2,1H3;1H
SMILES:COc1ccccc1C1(CCN(CCCn2c3ccccc3c3ccccc23)CC1)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NNC052090
CAS:NNC052090 inhibits GABA uptake, favoring hBGT-1 (Ki=1.4μM), affects α1/D2 receptors (IC50=266/1632nM).Formula:C27H30N2O2Color and Shape:SolidMolecular weight:414.54
