CAS 18486-76-5
:2-Amino-2-butenediamide
Description:
2-Amino-2-butenediamide, with the CAS number 18486-76-5, is an organic compound characterized by the presence of both amino and amide functional groups. It features a butenediamide structure, which includes a double bond between the second and third carbon atoms of a four-carbon chain, contributing to its reactivity and potential for various chemical transformations. This compound is typically a white to off-white solid and is soluble in water due to the polar nature of its functional groups. The presence of amino groups allows for hydrogen bonding, enhancing its solubility in polar solvents. 2-Amino-2-butenediamide may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its reactivity can be attributed to the double bond and the amide functionalities, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H7N3O2
InChI:InChI=1/C4H7N3O2/c5-2(4(7)9)1-3(6)8/h1H,5H2,(H2,6,8)(H2,7,9)/b2-1-
SMILES:C(=C(\C(=N)O)/N)/C(=N)O
Synonyms:- 1-Amino-1,2-ethylenedicarboxamide
- Aminobutenediamide
- (2Z)-2-aminobut-2-enediamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-2-butenediamide
CAS:Controlled ProductApplications 2-Amino-2-butenediamide (cas# 18486-76-5) is a compound useful in organic synthesis.
Formula:C4H7N3O2Color and Shape:NeatMolecular weight:129.12
