CymitQuimica logo

CAS 184888-43-5

:

Carbamic acid, [(1R)-1-phenylethyl]-, 1,1-dimethylethyl ester

Description:
Carbamic acid, [(1R)-1-phenylethyl]-, 1,1-dimethylethyl ester, identified by CAS number 184888-43-5, is an organic compound that belongs to the class of carbamates. This substance features a carbamic acid moiety where the amine is substituted with a phenylethyl group, and the carboxyl group is esterified with a tert-butyl group. Its molecular structure contributes to its unique chemical properties, including moderate polarity due to the presence of both hydrophobic (phenyl and tert-butyl groups) and hydrophilic (carbamate functional group) regions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agricultural applications. It is typically synthesized through the reaction of isocyanates with alcohols or amines. The stability and reactivity of carbamates can vary, often influenced by the substituents attached to the nitrogen and carbon atoms. Safety data should be consulted for handling, as carbamates can have varying degrees of toxicity and environmental impact.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-10(11-8-6-5-7-9-11)14-12(15)16-13(2,3)4/h5-10H,1-4H3,(H,14,15)/t10-/m1/s1
InChI key:WOIRCKJMSPMDAM-SNVBAGLBSA-N
SMILES:C[C@H](C1=CC=CC=C1)NC(=O)OC(C)(C)C
Found 4 products.