CAS 1849-01-0
:1-METHYL-2-BENZIMIDAZOLINONE
Description:
1-Methyl-2-benzimidazolinone is an organic compound characterized by its bicyclic structure, which includes a benzimidazole moiety. It is typically a white to off-white crystalline solid that is soluble in polar organic solvents. This compound is known for its role as a ligand in coordination chemistry, particularly in the formation of metal complexes, which can exhibit interesting catalytic and photophysical properties. The presence of the methyl group at the 1-position enhances its stability and solubility compared to other benzimidazoles. Additionally, 1-methyl-2-benzimidazolinone has been studied for its potential applications in various fields, including pharmaceuticals and materials science, due to its ability to interact with biological systems and its utility in organic synthesis. Its chemical behavior is influenced by the nitrogen atoms in the ring, which can participate in hydrogen bonding and coordination with metal ions. Overall, this compound is of interest for its diverse applications and unique chemical properties.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c1-10-7-5-3-2-4-6(7)9-8(10)11/h2-5H,1H3,(H,9,11)
SMILES:Cn1c2ccccc2nc1O
Synonyms:- Akos 90531
- 1-Methyl-1,3-Dihydro-2H-Benzimidazol-2-One
- Rarechem Aq Nn 0101
- 2H-Benzimidazol-2-one,1,3-dihydro-1-methyl-(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methyl-2-benzimidazolinone
CAS:Formula:C8H8N2OPurity:98%Color and Shape:SolidMolecular weight:148.16191-Methyl-1H-benzo[d]imidazol-2(3H)-one
CAS:Formula:C8H8N2OPurity:96%Color and Shape:SolidMolecular weight:148.1651,3-Dihydro-1-methyl-2H-benzimidazol-2-one
CAS:1,3-Dihydro-1-methyl-2H-benzimidazol-2-oneFormula:C8H8N2OPurity:98%Color and Shape: red-brown solidMolecular weight:148.16g/mol1-Methyl-2-benzimidazolinone
CAS:1-Methyl-2-benzimidazolinone is a synthetic compound that has been shown to be cytotoxic to cancer cells. It binds to metal ions and forms reactive intermediates, which are able to react with nucleophiles in cellular macromolecules. The reaction mechanism of 1-methyl-2-benzimidazolinone is similar to the reaction of picolinic acid with metal hydroxides. The heteroarylations of this compound have also been studied using chemical ligation, and it has been found that the d4 receptor may play a role in its cytotoxicity.
Formula:C8H8N2OPurity:Min. 95%Molecular weight:148.16 g/mol



