CymitQuimica logo

CAS 1849-25-8

:

4-(Phenylethynyl)aniline

Description:
4-(Phenylethynyl)aniline, with the CAS number 1849-25-8, is an organic compound characterized by the presence of both an aniline group and a phenylethynyl substituent. This compound features a phenyl group attached to an ethynyl group, which is further connected to an aniline moiety. It typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other electronic devices. The compound exhibits properties such as good thermal stability and solubility in organic solvents, which are advantageous for various chemical reactions and applications. Additionally, due to the presence of the ethynyl group, it can participate in cross-coupling reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C14H11N
InChI:InChI=1S/C14H11N/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-5,8-11H,15H2
InChI key:ODFQRHOQXHVJTQ-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C#CC2=CC=C(C=C2)N
Synonyms:
  • Benzenamine, 4-(phenylethynyl)-
Found 5 products.