CAS 1849-27-0
:1,4-Bis(2-phenylethynyl)benzene
Description:
1,4-Bis(2-phenylethynyl)benzene, with the CAS number 1849-27-0, is an organic compound characterized by its structure, which features a central benzene ring with two phenylethynyl substituents at the 1 and 4 positions. This compound is notable for its potential applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other optoelectronic devices due to its conjugated system, which allows for efficient electron delocalization. It typically exhibits good thermal stability and can be synthesized through various organic reactions, including Sonogashira coupling. The presence of the ethynyl groups contributes to its unique electronic properties, making it a subject of interest in research focused on organic semiconductors. Additionally, its solid-state properties can be influenced by crystallization and molecular packing, which are crucial for its performance in practical applications. Overall, 1,4-Bis(2-phenylethynyl)benzene is a significant compound in the field of organic chemistry and materials science.
Formula:C22H14
InChI:InChI=1S/C22H14/c1-3-7-19(8-4-1)11-13-21-15-17-22(18-16-21)14-12-20-9-5-2-6-10-20/h1-10,15-18H
InChI key:InChIKey=FPVSTPLZJLYNMB-UHFFFAOYSA-N
SMILES:C(#CC1=CC=CC=C1)C2=CC=C(C#CC3=CC=CC=C3)C=C2
Synonyms:- Benzene, 1,4-bis(2-phenylethynyl)-
- Benzene, p-bis(phenylethynyl)-
- p-Bis(phenylethynyl)benzene
- 1,4-Bis(2-phenylethynyl)benzene
- Benzene, 1,4-bis(phenylethynyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Bis(phenylethynyl)benzene, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C22H14Purity:97%Color and Shape:White to cream or pale yellow, Crystalline powder or powderMolecular weight:278.361,4-Bis(phenylethynyl)benzene
CAS:Formula:C22H14Purity:98%Color and Shape:SolidMolecular weight:278.34661,4-Bis(phenylethynyl)benzene
CAS:1,4-Bis(phenylethynyl)benzenePurity:98%Molecular weight:278.35g/mol1,4-Bis(phenylethynyl)benzene
CAS:1,4-Bis(phenylethynyl)benzene is a fluorescent derivative of the molecule with a skeleton that can be used to create polymers with fluorescence properties. The fluorescent derivative emits light at approximately 350 nm when excited by ultraviolet radiation. It has been shown that this molecule is able to form polymers that are sensitive to various gases and vapors. The polymer film will fluoresce in the presence of an optical sensor, which can be used as a sensor for carbon dioxide, ammonia, or sulfur hexafluoride. 1,4-Bis(phenylethynyl)benzene is also able to absorb ultraviolet radiation of wavelengths between 200 and 400 nm and emit light at longer wavelengths.Formula:C22H14Purity:Min. 95%Color and Shape:PowderMolecular weight:278.35 g/mol




