CAS 1849-76-9

3-bromo-5-chloro-4-hydroxybenzaldehyde

Description:

3-Bromo-5-chloro-4-hydroxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, a chlorine atom, a hydroxyl group, and an aldehyde functional group. The presence of the hydroxyl group (–OH) contributes to its potential as a phenolic compound, which may exhibit various biological activities. The bromine and chlorine substituents can influence the compound's reactivity and solubility, making it useful in synthetic organic chemistry. This compound is typically a solid at room temperature and may have moderate solubility in polar solvents due to the hydroxyl group. Its chemical properties allow it to participate in various reactions, such as electrophilic aromatic substitution and nucleophilic addition, making it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.

Formula: C₇H₄BrClO₂

InChI: InChI=1/C7H4BrClO2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H

SMILES: c1c(cc(c(c1Br)O)Cl)C=O

Synonyms:

• Benzaldehyde, 3-Bromo-5-Chloro-4-Hydroxy-

3-Bromo-5-chloro-4-hydroxybenzaldehyde

CAS: 1849-76-9

Formula: C₇H₄BrClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 235.4625

Ref: IN-DA003J2K

3-Bromo-5-Chloro-4-Hydroxybenzaldehyde

CAS: 1849-76-9

3-Bromo-5-Chloro-4-Hydroxybenzaldehyde

Purity: 99%

Molecular weight: 235.46g/mol

Ref: 54-OR1028521

3-Bromo-5-chloro-4-hydroxybenzaldehyde

CAS: 1849-76-9

Formula: C₇H₄BrClO₂

Purity: 97%

Molecular weight: 235.46

Ref: 10-F231145

3-Bromo-5-chloro-4-hydroxybenzaldehyde

CAS: 1849-76-9

3-Bromo-5-chloro-4-hydroxybenzaldehyde (3BCHA) is a phenolic compound that has been used in the synthesis of new drugs. 3BCHA is produced by the ozonation of 2,6-dichlorophenol and subsequent reactions with sodium hydroxide and hydrogen peroxide. The production of 3BCHA can be monitored using gas chromatography/electron spray ionization mass spectrometry (GC/ESI MS). 3BCHA can be synthesized in two ways:

Formula: C₇H₄BrClO₂

Purity: Min. 95%

Molecular weight: 235.46 g/mol

Ref: 3D-BAA84976