CAS 184913-19-7
:Isoquinoline, 3,4-dihydro-7-methoxy-
Description:
Isoquinoline, 3,4-dihydro-7-methoxy- is a chemical compound that belongs to the isoquinoline family, characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. This specific compound features a methoxy group (-OCH3) at the 7-position and is partially saturated, indicated by the "3,4-dihydro" designation, which means it has two additional hydrogen atoms compared to fully aromatic isoquinoline. The presence of the methoxy group can influence its chemical reactivity and solubility, often enhancing its lipophilicity. Isoquinolines are known for their biological activity, and derivatives like this one may exhibit pharmacological properties, making them of interest in medicinal chemistry. The compound's molecular structure contributes to its potential applications in drug development, particularly in the fields of neuropharmacology and cancer research. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c1-12-10-3-2-8-4-5-11-7-9(8)6-10/h2-3,6-7H,4-5H2,1H3
SMILES:COc1ccc2CCN=Cc2c1
Synonyms:- 7-Methoxy-3,4-dihydroisochinolin
- 7-Methoxy-3,4-dihydroisoquinoline
- 3,4-Dihydro-7-Methoxyisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
