CymitQuimica logo

CAS 1849196-57-1

:

1-(2-hydroxyethyl)cyclopropane-1-carbonitrile

Description:
1-(2-Hydroxyethyl)cyclopropane-1-carbonitrile is an organic compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring known for its strain and reactivity. The presence of a hydroxyl group (-OH) attached to a two-carbon ethyl chain contributes to its polarity and potential for hydrogen bonding, influencing its solubility in polar solvents. The carbonitrile functional group (-C≡N) introduces a strong electron-withdrawing characteristic, which can affect the compound's reactivity and stability. This compound may exhibit interesting chemical behavior due to the combination of its cyclic structure and functional groups, making it potentially useful in various synthetic applications or as an intermediate in organic synthesis. Its unique structure may also impart specific biological activities, warranting further investigation in medicinal chemistry. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of the carbonitrile group, which can be toxic and requires careful management in laboratory settings.
Formula:C6H9NO
InChI:InChI=1S/C6H9NO/c7-5-6(1-2-6)3-4-8/h8H,1-4H2
InChI key:NFMCQNMBFLPELK-UHFFFAOYSA-N
SMILES:C1CC1(CCO)C#N
Found 3 products.