CAS 18493-34-0

3-(2,4-Dimethoxyphenyl)-1-(4-methoxyphenyl)-2-propen-1-one

Description:

3-(2,4-Dimethoxyphenyl)-1-(4-methoxyphenyl)-2-propen-1-one, also known by its CAS number 18493-34-0, is an organic compound characterized by its structure, which features a propenone backbone substituted with two methoxyphenyl groups. This compound typically exhibits properties associated with chalcones, a class of compounds known for their potential biological activities, including anti-inflammatory, antioxidant, and anticancer properties. The presence of methoxy groups enhances its lipophilicity and may influence its reactivity and interaction with biological targets. In terms of physical properties, chalcones often display a yellow to orange coloration and can be solid at room temperature. The compound's solubility is generally influenced by the presence of the methoxy groups, which can improve solubility in organic solvents. Additionally, the compound may undergo various chemical reactions, such as condensation and reduction, making it of interest in synthetic organic chemistry and medicinal chemistry research. Overall, this compound represents a significant area of study due to its potential applications in pharmaceuticals and materials science.

Formula: C₁₈H₁₈O₄

InChI: InChI=1/C18H18O4/c1-20-15-8-4-13(5-9-15)17(19)11-7-14-6-10-16(21-2)12-18(14)22-3/h4-12H,1-3H3/b11-7+

InChI key: InChIKey=QASJJCFLWLUQLE-UHFFFAOYSA-N

SMILES: C(=CC(=O)C1=CC=C(OC)C=C1)C2=C(OC)C=C(OC)C=C2

Synonyms:

• (2E)-3-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one
• 2-Propen-1-one, 3-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-
• 3-(2,4-Dimethoxyphenyl)-1-(4-Methoxyphenyl)Prop-2-En-1-One
• 3-(2,4-Dimethoxyphenyl)-1-(4-methoxyphenyl)-2-propen-1-one
• 4-Methoxyphenyl 2-(2,4-dimethoxyphenyl)ethenyl ketone
• Chalcone, 2,4,4′-trimethoxy-
• 2,4,4′-Trimethoxychalcone

2,4,4'-Trimethoxychalcone

CAS: 18493-34-0

2,4,4'-Trimethoxychalcone

Purity: ≥95%

Molecular weight: 298.33g/mol

Ref: 54-OR54403

2,4,4'-Trimethoxychalcone

CAS: 18493-34-0

2,4,4'-Trimethoxychalcone is a chalcone derivative, which is a type of flavonoid. Chalcones are phenolic compounds known for their open-chain structure, comprising aromatic ketone and enone systems. This product is typically synthesized through the Claisen-Schmidt condensation of appropriate aromatic aldehydes and ketones. Its mode of action involves interference with cellular signaling pathways and modulation of enzyme activities, which may contribute to its antioxidative, anti-inflammatory, and anticancer properties.

Formula: C₁₈H₁₈O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 298.33 g/mol

Ref: 3D-FT67803

(2E)-3-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one

CAS: 18493-34-0

Formula: C₁₈H₁₈O₄

Purity: 95.0%

Molecular weight: 298.338

Ref: 10-F523615