CAS 184951-32-4

4-Pyrimidinecarbonyl chloride (9CI)

Description:

4-Pyrimidinecarbonyl chloride, also known as 4-pyrimidinecarboxylic acid chloride, is an organic compound characterized by the presence of a pyrimidine ring substituted with a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly as an acylating agent, making it useful in organic synthesis, especially in the preparation of amides and esters. The carbonyl chloride group is highly reactive, allowing it to readily react with nucleophiles, including amines and alcohols. Additionally, 4-pyrimidinecarbonyl chloride is soluble in organic solvents such as dichloromethane and ether, but it is generally not soluble in water due to its hydrophobic nature. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon contact with moisture. Overall, its unique structure and reactivity make it a valuable intermediate in pharmaceutical and agrochemical synthesis.

Formula: C₅H₃ClN₂O

InChI: InChI=1/C5H3ClN2O/c6-5(9)4-1-2-7-3-8-4/h1-3H

SMILES: c1cncnc1C(=O)Cl

Synonyms:

• 4-Pyrimidinecarbonyl Chloride
• Pyrimidine-4-carbonyl chloride

Pyrimidine-4-carbonyl chloride

CAS: 184951-32-4

Pyrimidine-4-carbonyl chloride

Formula: C₅H₃ClN₂O

Purity: 95%

Color and Shape: dark solid

Molecular weight: 142.54g/mol

Ref: 54-OR200047