CAS 1849590-02-8

Spiro[cyclohexane-1,3′(2′H)-imidazo[1,5-a]pyridine]-1′,5′-dione, 6′-[(6-amino-4-pyrimidinyl)amino]-8′-methyl-, hydrochloride (1:1)

Description:

Spiro[cyclohexane-1,3′(2′H)-imidazo[1,5-a]pyridine]-1′,5′-dione, 6′-[(6-amino-4-pyrimidinyl)amino]-8′-methyl-, hydrochloride (1:1), identified by CAS number 1849590-02-8, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both imidazo and pyridine moieties. This compound features a bicyclic framework that contributes to its potential biological activity, particularly in medicinal chemistry. The presence of amino and methyl groups suggests possible interactions with biological targets, making it a candidate for further pharmacological studies. As a hydrochloride salt, it is likely to exhibit improved solubility and stability in aqueous environments, which is advantageous for drug formulation. The compound's structural intricacies may influence its reactivity and interaction with enzymes or receptors, warranting investigation into its therapeutic applications. Overall, this substance represents a noteworthy example of synthetic organic chemistry with implications in drug discovery and development.

Formula: C₁₇H₂₀N₆O₂·ClH

InChI: InChI=1S/C17H20N6O2.ClH/c1-10-7-11(21-13-8-12(18)19-9-20-13)16(25)23-14(10)15(24)22-17(23)5-3-2-4-6-17;/h7-9H,2-6H2,1H3,(H,22,24)(H3,18,19,20,21);1H

InChI key: InChIKey=WBGPPUUXCGKTSC-UHFFFAOYSA-N

SMILES: O=C1N2C3(NC(=O)C2=C(C)C=C1NC=4C=C(N)N=CN4)CCCCC3.Cl

Synonyms:

• Spiro[cyclohexane-1,3′(2′H)-imidazo[1,5-a]pyridine]-1′,5′-dione, 6′-[(6-amino-4-pyrimidinyl)amino]-8′-methyl-, hydrochloride (1:1)

Tomivosertib HCl

CAS: 1849590-02-8

Tomivosertib (eFT508) is a MNK1/2 inhibitor that blocks eIF4E phosphorylation, hindering tumor growth and immune signaling.

Formula: C₁₇H₂₁ClN₆O₂

Color and Shape: Solid

Molecular weight: 376.845

Ref: TM-T70124

Tomivosertib hydrochloride

CAS: 1849590-02-8

Tomivosertib hydrochloride is an investigational small molecule inhibitor targeting the mitogen-activated protein kinase interacting kinase (MNK) pathway, which is a synthetic product derived from chemical synthesis. Its mode of action involves the selective inhibition of MNK1 and MNK2 enzymes, leading to the disruption of the phosphorylation of eIF4E, a key component in the translation initiation process. This interruption suppresses the production of oncogenic proteins involved in tumor growth and metastasis.

Formula: C₁₇H₂₁ClN₆O₂

Purity: Min. 95%

Molecular weight: 376.8 g/mol

Ref: 3D-ZYC59002