CAS 18496-40-7
:Platinum dinitrate
Description:
Platinum dinitrate, with the CAS number 18496-40-7, is a chemical compound that features platinum in a coordination complex with nitrate ions. It typically appears as a yellow to orange solid and is known for its relatively high stability compared to other platinum compounds. The compound is characterized by its coordination number, which is influenced by the geometry of the platinum center, often exhibiting square planar or octahedral arrangements. Platinum dinitrate is soluble in polar solvents, which can facilitate its use in various chemical reactions and applications. It is important to handle this compound with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory settings. Additionally, platinum dinitrate can serve as a precursor in the synthesis of other platinum-containing compounds, contributing to its relevance in coordination chemistry and catalysis.
Formula:HNO3Pt
InChI:InChI=1S/HNO3.Pt/c2-1(3)4;/h(H,2,3,4);
InChI key:InChIKey=UYXRCZUOJAYSQR-UHFFFAOYSA-N
SMILES:N(=O)(=O)O.[Pt]
Synonyms:- Nitric acid, platinum(2+) salt
- Nitric acid, platinum(2+) salt (2:1)
- Platinum dinitrate
- Platinum nitrate
- Platinum nitrate (Pt(NO<sub>3</sub>)<sub>2</sub>)
- Platinum(2+) Dinitrate
- Platinum(2+) nitrate
- Platinum nitrate (Pt(NO3)2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Nitric acid, platinum(2+) salt
CAS:Formula:N2O6PtPurity:98%Color and Shape:SolidMolecular weight:319.0878Platinum(II) nitrate, 99.95% (metals basis)
CAS:Formula:Pt(NO3)2Purity:≥ 99.95%Color and Shape:Orange-yellow to brown crystalline powderMolecular weight:319.08Platinum(II) nitrate
CAS:<p>Platinum(II) nitrate is a chemical compound that is the reaction product of platinum and nitric acid. It has a high resistance to oxidation, which makes it an excellent catalyst for water vapor and hydrochloric acid. Platinum(II) nitrate also has anti-cancer properties, which are due to its ability to inhibit human serum albumin production by preventing the formation of hydrogen bonds between the protein molecule and other substances. This compound is also used in wastewater treatment as a catalyst. It functions as a catalyst by reacting with water vapor, forming hydroxide ions, which then react with acids in wastewater to form hydrogen gas and salt. The resulting product is clean water after the platinum(II) ion has been removed from reaction. This compound can be used as a fluorescent resonance energy transfer (FRET) probe for studying protein-protein interactions in cells.</p>Formula:(HNO3)2•PtPurity:Min. 95%Color and Shape:Orange PowderMolecular weight:319.08 g/mol




