CAS 18499-92-8
:Kermesic acid
Description:
Kermesic acid, with the CAS number 18499-92-8, is a naturally occurring organic compound classified as a flavonoid. It is primarily derived from certain plant sources, particularly those in the family of oak and other species that produce kermes dye. Kermesic acid is characterized by its polyphenolic structure, which contributes to its antioxidant properties. This compound exhibits a range of biological activities, including potential anti-inflammatory and antimicrobial effects. In terms of solubility, kermesic acid is generally soluble in organic solvents but may have limited solubility in water, typical of many flavonoids. Its chemical structure includes multiple hydroxyl groups, which enhance its reactivity and interaction with various biological systems. Kermesic acid is of interest in both natural product chemistry and pharmacology, as it may have applications in developing natural dyes and as a potential therapeutic agent. Further research is ongoing to fully elucidate its mechanisms of action and potential health benefits.
Formula:C16H10O8
InChI:InChI=1S/C16H10O8/c1-4-9-5(2-6(17)10(4)16(23)24)13(20)12-11(15(9)22)7(18)3-8(19)14(12)21/h2-3,17-19,21H,1H3,(H,23,24)
InChI key:InChIKey=CXORMDKZEUMQHX-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(O)C(O)=CC3O)=C(C)C(C(O)=O)=C(O)C2
Synonyms:- 1-Methyl-2-carboxy-3,5,6,8-tetrahydroxyanthraquinone
- 2-Anthracenecarboxylic acid, 9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo-
- 2-Anthroic acid, 9,10-dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo-
- 9,10-Dihydro-3,5,6,8-tetrahydroxy-1-methyl-9,10-dioxo-2-anthracenecarboxylic acid
- Kermes
- Kermes (dye)
- Kermes Red
- Kermesic Acid
- C.I. Natural Red 3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Kermesic acid
CAS:Kermesic acid is a hydroxybenzoic acid that is used as a food dye. It can be found in some red wines and it is also used to color the eggs of a particular breed of chicken. The most common use for kermesic acid is as an oxidizing agent in a chromatographic method, which separates molecules based on their size. The oxidation catalyst used can vary, but often trifluoroacetic acid (TFA) is used. TFA reacts with the kermesic acid to form an octaketide, which has the chemical formula C8H6O3. This octaketide then reacts with another molecule of TFA to form two esters.Formula:C16H10O8Purity:Min. 95%Molecular weight:330.25 g/mol

