
CAS 185022-23-5
:2-[2-(2-Hydroxyethoxy)ethoxy]-1H-isoindole-1,3(2H)-dione
Description:
2-[2-(2-Hydroxyethoxy)ethoxy]-1H-isoindole-1,3(2H)-dione, with the CAS number 185022-23-5, is a synthetic organic compound characterized by its isoindole structure, which features a dione functional group. This compound typically exhibits solubility in polar solvents due to the presence of hydroxy and ether groups, which enhance its hydrophilicity. The hydroxyethoxy substituents contribute to its potential reactivity and interactions with biological systems, making it of interest in medicinal chemistry. Its isoindole core may impart unique electronic properties, influencing its behavior in various chemical reactions. The compound's stability, reactivity, and potential applications can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, this compound represents a class of molecules that may have applications in pharmaceuticals or materials science, warranting further investigation into its properties and potential uses.
Formula:C12H13NO5
InChI:InChI=1S/C12H13NO5/c14-5-6-17-7-8-18-13-11(15)9-3-1-2-4-10(9)12(13)16/h1-4,14H,5-8H2
InChI key:InChIKey=ZCMQVTBCWMEJCS-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1OCCOCCO)=CC=CC2
Synonyms:- N-[2-(2-Hydroxyethoxy)ethoxy]phthalimide
- 2-[2-(2-Hydroxyethoxy)ethoxy]-1H-isoindole-1,3(2H)-dione
- 1H-Isoindole-1,3(2H)-dione, 2-[2-(2-hydroxyethoxy)ethoxy]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery