CAS 185030-83-5: 2-Chloro-L-phenylalanine

Description:2-Chloro-L-phenylalanine is an amino acid derivative characterized by the presence of a chlorine atom at the second carbon position of the phenylalanine structure. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It exhibits properties typical of amino acids, including the ability to form zwitterions, which are molecules that have both positive and negative charges. The chlorine substitution can influence its reactivity and interactions with biological systems, potentially affecting protein structure and function. 2-Chloro-L-phenylalanine is often used in biochemical research, particularly in studies involving enzyme inhibition and the synthesis of modified peptides. Its unique structure allows it to serve as a useful tool in understanding the role of amino acid side chains in protein interactions and functions. Additionally, it may have applications in drug development and the study of metabolic pathways. As with many chemical substances, proper handling and safety precautions are essential due to its potential biological effects.

Formula:C₉H₁₀ClNO₂

InChI:InChI=1/C9H10ClNO2.ClH/c10-7-4-2-1-3-6(7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m0./s1

Synonyms:
Rarechem Bk Pt 0001
(S)-2-Amino-3-(2-Chloro-Phenyl)-Propionic Acid
O-Chloro-L-Phenylalanine
Timtec-Bb Sbb003552
H-O-Chloro-L-Phe-Oh
H-L-Phe(2-Cl)-Oh
H-Phe(O-Cl)-Oh
L-2-Chlorophe
L-2-Chlorophenylalanine
(2R)-2-ammonio-3-(2-chlorophenyl)propanoate
See more synonyms
H-Phe(2-Cl)-OH
(S)-2-Amino-3-(2-chlorophenyl)propanoic acid

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-CHLORO-L-PHENYLALANINE REF: IN-DA007RRNCAS: 185030-83-5	- - -	To inquire	Thu 17 Apr 25
	(S)-2-Amino-3-(2-chlorophenyl)propanoic acid hydrochloride REF: 3D-KHA03083CAS: 185030-83-5	Min. 95%	- - -	Discontinued product